C16H18FNS — CID 64620706
2-(4-fluorophenyl)sulfanyl-N-methyl-1-(3-methylphenyl)ethanamine (PubChem CID 64620706) has the molecular formula C16H18FNS and a molecular weight of 275.39 g/mol. Its IUPAC name is 2-(4-fluorophenyl)sulfanyl-N-methyl-1-(3-methylphenyl)ethanamine.
| Compound Name | 2-(4-fluorophenyl)sulfanyl-N-methyl-1-(3-methylphenyl)ethanamine |
|---|---|
| PubChem CID | 64620706 |
| Molecular Formula | C16H18FNS |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | 2-(4-fluorophenyl)sulfanyl-N-methyl-1-(3-methylphenyl)ethanamine |
| SMILES | CNC(CSc1ccc(F)cc1)c1cccc(C)c1 |
| InChI | InChI=1S/C16H18FNS/c1-12-4-3-5-13(10-12)16(18-2)11-19-15-8-6-14(17)7-9-15/h3-10,16,18H,11H2,1-2H3 |
| InChIKey | SPWFHYDGVQQOEW-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |