C9H17BrN4O — CID 106462218
N-[1-(5-bromo-3-methyltriazol-4-yl)-2-methoxyethyl]propan-1-amine (PubChem CID 106462218) has the molecular formula C9H17BrN4O and a molecular weight of 277.17 g/mol. Its IUPAC name is N-[1-(5-bromo-3-methyltriazol-4-yl)-2-methoxyethyl]propan-1-amine.
| Compound Name | N-[1-(5-bromo-3-methyltriazol-4-yl)-2-methoxyethyl]propan-1-amine |
|---|---|
| PubChem CID | 106462218 |
| Molecular Formula | C9H17BrN4O |
| Molecular Weight | 277.17 g/mol |
| Exact Mass | 276.06 |
| IUPAC Name | N-[1-(5-bromo-3-methyltriazol-4-yl)-2-methoxyethyl]propan-1-amine |
| SMILES | CCCNC(COC)c1c(Br)nnn1C |
| InChI | InChI=1S/C9H17BrN4O/c1-4-5-11-7(6-15-3)8-9(10)12-13-14(8)2/h7,11H,4-6H2,1-3H3 |
| InChIKey | GAJHUXRWYPCIGA-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.17 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |