C11H19BrN4 — CID 106464880
1-(5-bromo-3-methyltriazol-4-yl)-2-cyclopropyl-N-ethylpropan-1-amine (PubChem CID 106464880) has the molecular formula C11H19BrN4 and a molecular weight of 287.21 g/mol. Its IUPAC name is 1-(5-bromo-3-methyltriazol-4-yl)-2-cyclopropyl-N-ethylpropan-1-amine.
| Compound Name | 1-(5-bromo-3-methyltriazol-4-yl)-2-cyclopropyl-N-ethylpropan-1-amine |
|---|---|
| PubChem CID | 106464880 |
| Molecular Formula | C11H19BrN4 |
| Molecular Weight | 287.21 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | 1-(5-bromo-3-methyltriazol-4-yl)-2-cyclopropyl-N-ethylpropan-1-amine |
| SMILES | CCNC(c1c(Br)nnn1C)C(C)C1CC1 |
| InChI | InChI=1S/C11H19BrN4/c1-4-13-9(7(2)8-5-6-8)10-11(12)14-15-16(10)3/h7-9,13H,4-6H2,1-3H3 |
| InChIKey | RJHMLWYGTXHLKY-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.21 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |