C13H23BrN4 — CID 106830779
N-[(5-bromo-3-methyltriazol-4-yl)-(1-methylcyclohexyl)methyl]ethanamine (PubChem CID 106830779) has the molecular formula C13H23BrN4 and a molecular weight of 315.26 g/mol. Its IUPAC name is N-[(5-bromo-3-methyltriazol-4-yl)-(1-methylcyclohexyl)methyl]ethanamine.
| Compound Name | N-[(5-bromo-3-methyltriazol-4-yl)-(1-methylcyclohexyl)methyl]ethanamine |
|---|---|
| PubChem CID | 106830779 |
| Molecular Formula | C13H23BrN4 |
| Molecular Weight | 315.26 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | N-[(5-bromo-3-methyltriazol-4-yl)-(1-methylcyclohexyl)methyl]ethanamine |
| SMILES | CCNC(c1c(Br)nnn1C)C1(C)CCCCC1 |
| InChI | InChI=1S/C13H23BrN4/c1-4-15-11(10-12(14)16-17-18(10)3)13(2)8-6-5-7-9-13/h11,15H,4-9H2,1-3H3 |
| InChIKey | FHKSMAKJIVCLMG-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.26 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |