C14H24BrN5 — CID 106462661
1-(5-bromo-3-methyltriazol-4-yl)-N-methyl-1-(1-pyrrolidin-1-ylcyclopentyl)methanamine (PubChem CID 106462661) has the molecular formula C14H24BrN5 and a molecular weight of 342.29 g/mol. Its IUPAC name is 1-(5-bromo-3-methyltriazol-4-yl)-N-methyl-1-(1-pyrrolidin-1-ylcyclopentyl)methanamine.
| Compound Name | 1-(5-bromo-3-methyltriazol-4-yl)-N-methyl-1-(1-pyrrolidin-1-ylcyclopentyl)methanamine |
|---|---|
| PubChem CID | 106462661 |
| Molecular Formula | C14H24BrN5 |
| Molecular Weight | 342.29 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | 1-(5-bromo-3-methyltriazol-4-yl)-N-methyl-1-(1-pyrrolidin-1-ylcyclopentyl)methanamine |
| SMILES | CNC(c1c(Br)nnn1C)C1(N2CCCC2)CCCC1 |
| InChI | InChI=1S/C14H24BrN5/c1-16-12(11-13(15)17-18-19(11)2)14(7-3-4-8-14)20-9-5-6-10-20/h12,16H,3-10H2,1-2H3 |
| InChIKey | QTYAEQYASLJIEV-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.29 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |