C12H21BrN4O2 — CID 106463020
1-(5-bromo-3-methyltriazol-4-yl)-1-(4-ethoxyoxan-4-yl)-N-methylmethanamine (PubChem CID 106463020) has the molecular formula C12H21BrN4O2 and a molecular weight of 333.23 g/mol. Its IUPAC name is 1-(5-bromo-3-methyltriazol-4-yl)-1-(4-ethoxyoxan-4-yl)-N-methylmethanamine.
| Compound Name | 1-(5-bromo-3-methyltriazol-4-yl)-1-(4-ethoxyoxan-4-yl)-N-methylmethanamine |
|---|---|
| PubChem CID | 106463020 |
| Molecular Formula | C12H21BrN4O2 |
| Molecular Weight | 333.23 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | 1-(5-bromo-3-methyltriazol-4-yl)-1-(4-ethoxyoxan-4-yl)-N-methylmethanamine |
| SMILES | CCOC1(C(NC)c2c(Br)nnn2C)CCOCC1 |
| InChI | InChI=1S/C12H21BrN4O2/c1-4-19-12(5-7-18-8-6-12)10(14-2)9-11(13)15-16-17(9)3/h10,14H,4-8H2,1-3H3 |
| InChIKey | GFWAVRNFZYGFQB-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 61.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.23 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |