C12H9Br2ClFNS — CID 114019799
1-(5-bromo-4-chlorothiophen-2-yl)-1-(3-bromo-4-fluorophenyl)-N-methylmethanamine (PubChem CID 114019799) has the molecular formula C12H9Br2ClFNS and a molecular weight of 413.54 g/mol. Its IUPAC name is 1-(5-bromo-4-chlorothiophen-2-yl)-1-(3-bromo-4-fluorophenyl)-N-methylmethanamine.
| Compound Name | 1-(5-bromo-4-chlorothiophen-2-yl)-1-(3-bromo-4-fluorophenyl)-N-methylmethanamine |
|---|---|
| PubChem CID | 114019799 |
| Molecular Formula | C12H9Br2ClFNS |
| Molecular Weight | 413.54 g/mol |
| Exact Mass | 410.85 |
| IUPAC Name | 1-(5-bromo-4-chlorothiophen-2-yl)-1-(3-bromo-4-fluorophenyl)-N-methylmethanamine |
| SMILES | CNC(c1ccc(F)c(Br)c1)c1cc(Cl)c(Br)s1 |
| InChI | InChI=1S/C12H9Br2ClFNS/c1-17-11(10-5-8(15)12(14)18-10)6-2-3-9(16)7(13)4-6/h2-5,11,17H,1H3 |
| InChIKey | VUUWAPHZCGASJG-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.54 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |