C13H10BrClF3NOS — CID 116628654
1-(5-bromo-4-chlorothiophen-2-yl)-N-methyl-1-[4-(trifluoromethoxy)phenyl]methanamine (PubChem CID 116628654) has the molecular formula C13H10BrClF3NOS and a molecular weight of 400.65 g/mol. Its IUPAC name is 1-(5-bromo-4-chlorothiophen-2-yl)-N-methyl-1-[4-(trifluoromethoxy)phenyl]methanamine.
| Compound Name | 1-(5-bromo-4-chlorothiophen-2-yl)-N-methyl-1-[4-(trifluoromethoxy)phenyl]methanamine |
|---|---|
| PubChem CID | 116628654 |
| Molecular Formula | C13H10BrClF3NOS |
| Molecular Weight | 400.65 g/mol |
| Exact Mass | 398.93 |
| IUPAC Name | 1-(5-bromo-4-chlorothiophen-2-yl)-N-methyl-1-[4-(trifluoromethoxy)phenyl]methanamine |
| SMILES | CNC(c1ccc(OC(F)(F)F)cc1)c1cc(Cl)c(Br)s1 |
| InChI | InChI=1S/C13H10BrClF3NOS/c1-19-11(10-6-9(15)12(14)21-10)7-2-4-8(5-3-7)20-13(16,17)18/h2-6,11,19H,1H3 |
| InChIKey | INMLCASSRRTUPD-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.65 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |