C8H6BrClF5NS — CID 80530944
1-(5-bromo-4-chlorothiophen-2-yl)-2,2,3,3,3-pentafluoro-N-methylpropan-1-amine (PubChem CID 80530944) has the molecular formula C8H6BrClF5NS and a molecular weight of 358.56 g/mol. Its IUPAC name is 1-(5-bromo-4-chlorothiophen-2-yl)-2,2,3,3,3-pentafluoro-N-methylpropan-1-amine.
| Compound Name | 1-(5-bromo-4-chlorothiophen-2-yl)-2,2,3,3,3-pentafluoro-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 80530944 |
| Molecular Formula | C8H6BrClF5NS |
| Molecular Weight | 358.56 g/mol |
| Exact Mass | 356.90 |
| IUPAC Name | 1-(5-bromo-4-chlorothiophen-2-yl)-2,2,3,3,3-pentafluoro-N-methylpropan-1-amine |
| SMILES | CNC(c1cc(Cl)c(Br)s1)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H6BrClF5NS/c1-16-5(7(11,12)8(13,14)15)4-2-3(10)6(9)17-4/h2,5,16H,1H3 |
| InChIKey | BVHRJNJPOBYBDK-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.56 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|