C8H3Br2ClF6S — CID 103310769
2-bromo-5-[1-bromo-3,3,3-trifluoro-2-(trifluoromethyl)propyl]-3-chlorothiophene (PubChem CID 103310769) has the molecular formula C8H3Br2ClF6S and a molecular weight of 440.43 g/mol. Its IUPAC name is 2-bromo-5-[1-bromo-3,3,3-trifluoro-2-(trifluoromethyl)propyl]-3-chlorothiophene.
| Compound Name | 2-bromo-5-[1-bromo-3,3,3-trifluoro-2-(trifluoromethyl)propyl]-3-chlorothiophene |
|---|---|
| PubChem CID | 103310769 |
| Molecular Formula | C8H3Br2ClF6S |
| Molecular Weight | 440.43 g/mol |
| Exact Mass | 437.79 |
| IUPAC Name | 2-bromo-5-[1-bromo-3,3,3-trifluoro-2-(trifluoromethyl)propyl]-3-chlorothiophene |
| SMILES | FC(F)(F)C(C(Br)c1cc(Cl)c(Br)s1)C(F)(F)F |
| InChI | InChI=1S/C8H3Br2ClF6S/c9-4(3-1-2(11)6(10)18-3)5(7(12,13)14)8(15,16)17/h1,4-5H |
| InChIKey | PSKJUPRLQQKHJE-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.43 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|