C8H4Br2F6S — CID 103310733
2-bromo-5-[1-bromo-3,3,3-trifluoro-2-(trifluoromethyl)propyl]thiophene (PubChem CID 103310733) has the molecular formula C8H4Br2F6S and a molecular weight of 405.98 g/mol. Its IUPAC name is 2-bromo-5-[1-bromo-3,3,3-trifluoro-2-(trifluoromethyl)propyl]thiophene.
| Compound Name | 2-bromo-5-[1-bromo-3,3,3-trifluoro-2-(trifluoromethyl)propyl]thiophene |
|---|---|
| PubChem CID | 103310733 |
| Molecular Formula | C8H4Br2F6S |
| Molecular Weight | 405.98 g/mol |
| Exact Mass | 403.83 |
| IUPAC Name | 2-bromo-5-[1-bromo-3,3,3-trifluoro-2-(trifluoromethyl)propyl]thiophene |
| SMILES | FC(F)(F)C(C(Br)c1ccc(Br)s1)C(F)(F)F |
| InChI | InChI=1S/C8H4Br2F6S/c9-4-2-1-3(17-4)5(10)6(7(11,12)13)8(14,15)16/h1-2,5-6H |
| InChIKey | BJHHDQNRPOKFED-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.98 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|