C10H9BrF6S — CID 103310684
2-[1-bromo-3,3,3-trifluoro-2-(trifluoromethyl)propyl]-5-ethylthiophene (PubChem CID 103310684) has the molecular formula C10H9BrF6S and a molecular weight of 355.14 g/mol. Its IUPAC name is 2-[1-bromo-3,3,3-trifluoro-2-(trifluoromethyl)propyl]-5-ethylthiophene.
| Compound Name | 2-[1-bromo-3,3,3-trifluoro-2-(trifluoromethyl)propyl]-5-ethylthiophene |
|---|---|
| PubChem CID | 103310684 |
| Molecular Formula | C10H9BrF6S |
| Molecular Weight | 355.14 g/mol |
| Exact Mass | 353.95 |
| IUPAC Name | 2-[1-bromo-3,3,3-trifluoro-2-(trifluoromethyl)propyl]-5-ethylthiophene |
| SMILES | CCc1ccc(C(Br)C(C(F)(F)F)C(F)(F)F)s1 |
| InChI | InChI=1S/C10H9BrF6S/c1-2-5-3-4-6(18-5)7(11)8(9(12,13)14)10(15,16)17/h3-4,7-8H,2H2,1H3 |
| InChIKey | UKMOVXYEIISXIA-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.14 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|