C11H17BrClNS — CID 114874548
1-(5-bromo-4-chlorothiophen-2-yl)-N,3-dimethylpentan-1-amine (PubChem CID 114874548) has the molecular formula C11H17BrClNS and a molecular weight of 310.69 g/mol. Its IUPAC name is 1-(5-bromo-4-chlorothiophen-2-yl)-N,3-dimethylpentan-1-amine.
| Compound Name | 1-(5-bromo-4-chlorothiophen-2-yl)-N,3-dimethylpentan-1-amine |
|---|---|
| PubChem CID | 114874548 |
| Molecular Formula | C11H17BrClNS |
| Molecular Weight | 310.69 g/mol |
| Exact Mass | 309.00 |
| IUPAC Name | 1-(5-bromo-4-chlorothiophen-2-yl)-N,3-dimethylpentan-1-amine |
| SMILES | CCC(C)CC(NC)c1cc(Cl)c(Br)s1 |
| InChI | InChI=1S/C11H17BrClNS/c1-4-7(2)5-9(14-3)10-6-8(13)11(12)15-10/h6-7,9,14H,4-5H2,1-3H3 |
| InChIKey | OYAGZIBVPJGTLS-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.69 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |