C13H12BrCl2NS — CID 80531010
1-(5-bromo-4-chlorothiophen-2-yl)-2-(3-chlorophenyl)-N-methylethanamine (PubChem CID 80531010) has the molecular formula C13H12BrCl2NS and a molecular weight of 365.12 g/mol. Its IUPAC name is 1-(5-bromo-4-chlorothiophen-2-yl)-2-(3-chlorophenyl)-N-methylethanamine.
| Compound Name | 1-(5-bromo-4-chlorothiophen-2-yl)-2-(3-chlorophenyl)-N-methylethanamine |
|---|---|
| PubChem CID | 80531010 |
| Molecular Formula | C13H12BrCl2NS |
| Molecular Weight | 365.12 g/mol |
| Exact Mass | 362.93 |
| IUPAC Name | 1-(5-bromo-4-chlorothiophen-2-yl)-2-(3-chlorophenyl)-N-methylethanamine |
| SMILES | CNC(Cc1cccc(Cl)c1)c1cc(Cl)c(Br)s1 |
| InChI | InChI=1S/C13H12BrCl2NS/c1-17-11(12-7-10(16)13(14)18-12)6-8-3-2-4-9(15)5-8/h2-5,7,11,17H,6H2,1H3 |
| InChIKey | QWSNRNDYUOWIEY-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.12 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |