C12H13BrClNS2 — CID 80531359
N-[(5-bromo-4-chlorothiophen-2-yl)-(3-methylthiophen-2-yl)methyl]ethanamine (PubChem CID 80531359) has the molecular formula C12H13BrClNS2 and a molecular weight of 350.73 g/mol. Its IUPAC name is N-[(5-bromo-4-chlorothiophen-2-yl)-(3-methylthiophen-2-yl)methyl]ethanamine.
| Compound Name | N-[(5-bromo-4-chlorothiophen-2-yl)-(3-methylthiophen-2-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 80531359 |
| Molecular Formula | C12H13BrClNS2 |
| Molecular Weight | 350.73 g/mol |
| Exact Mass | 348.94 |
| IUPAC Name | N-[(5-bromo-4-chlorothiophen-2-yl)-(3-methylthiophen-2-yl)methyl]ethanamine |
| SMILES | CCNC(c1cc(Cl)c(Br)s1)c1sccc1C |
| InChI | InChI=1S/C12H13BrClNS2/c1-3-15-10(11-7(2)4-5-16-11)9-6-8(14)12(13)17-9/h4-6,10,15H,3H2,1-2H3 |
| InChIKey | WCUFOUYZIWMLJY-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.73 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |