C14H11Cl3IN — CID 103215149
1-(3-chloro-4-iodophenyl)-1-(2,5-dichlorophenyl)-N-methylmethanamine (PubChem CID 103215149) has the molecular formula C14H11Cl3IN and a molecular weight of 426.51 g/mol. Its IUPAC name is 1-(3-chloro-4-iodophenyl)-1-(2,5-dichlorophenyl)-N-methylmethanamine.
| Compound Name | 1-(3-chloro-4-iodophenyl)-1-(2,5-dichlorophenyl)-N-methylmethanamine |
|---|---|
| PubChem CID | 103215149 |
| Molecular Formula | C14H11Cl3IN |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 424.90 |
| IUPAC Name | 1-(3-chloro-4-iodophenyl)-1-(2,5-dichlorophenyl)-N-methylmethanamine |
| SMILES | CNC(c1ccc(I)c(Cl)c1)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C14H11Cl3IN/c1-19-14(8-2-5-13(18)12(17)6-8)10-7-9(15)3-4-11(10)16/h2-7,14,19H,1H3 |
| InChIKey | DVEOSRGVSMRZLV-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|