C14H11ClF2IN — CID 103215327
1-(3-chloro-4-iodophenyl)-1-(2,6-difluorophenyl)-N-methylmethanamine (PubChem CID 103215327) has the molecular formula C14H11ClF2IN and a molecular weight of 393.60 g/mol. Its IUPAC name is 1-(3-chloro-4-iodophenyl)-1-(2,6-difluorophenyl)-N-methylmethanamine.
| Compound Name | 1-(3-chloro-4-iodophenyl)-1-(2,6-difluorophenyl)-N-methylmethanamine |
|---|---|
| PubChem CID | 103215327 |
| Molecular Formula | C14H11ClF2IN |
| Molecular Weight | 393.60 g/mol |
| Exact Mass | 392.96 |
| IUPAC Name | 1-(3-chloro-4-iodophenyl)-1-(2,6-difluorophenyl)-N-methylmethanamine |
| SMILES | CNC(c1ccc(I)c(Cl)c1)c1c(F)cccc1F |
| InChI | InChI=1S/C14H11ClF2IN/c1-19-14(8-5-6-12(18)9(15)7-8)13-10(16)3-2-4-11(13)17/h2-7,14,19H,1H3 |
| InChIKey | VDEJYQZAARMHQE-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.60 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|