C15H13Cl2FIN — CID 103214727
2-(2-chloro-6-fluorophenyl)-1-(3-chloro-4-iodophenyl)-N-methylethanamine (PubChem CID 103214727) has the molecular formula C15H13Cl2FIN and a molecular weight of 424.08 g/mol. Its IUPAC name is 2-(2-chloro-6-fluorophenyl)-1-(3-chloro-4-iodophenyl)-N-methylethanamine.
| Compound Name | 2-(2-chloro-6-fluorophenyl)-1-(3-chloro-4-iodophenyl)-N-methylethanamine |
|---|---|
| PubChem CID | 103214727 |
| Molecular Formula | C15H13Cl2FIN |
| Molecular Weight | 424.08 g/mol |
| Exact Mass | 422.95 |
| IUPAC Name | 2-(2-chloro-6-fluorophenyl)-1-(3-chloro-4-iodophenyl)-N-methylethanamine |
| SMILES | CNC(Cc1c(F)cccc1Cl)c1ccc(I)c(Cl)c1 |
| InChI | InChI=1S/C15H13Cl2FIN/c1-20-15(9-5-6-14(19)12(17)7-9)8-10-11(16)3-2-4-13(10)18/h2-7,15,20H,8H2,1H3 |
| InChIKey | LLBYGVANNRDSHE-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.08 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|