C15H13ClF2IN — CID 103214822
1-(3-chloro-4-iodophenyl)-2-(2,4-difluorophenyl)-N-methylethanamine (PubChem CID 103214822) has the molecular formula C15H13ClF2IN and a molecular weight of 407.63 g/mol. Its IUPAC name is 1-(3-chloro-4-iodophenyl)-2-(2,4-difluorophenyl)-N-methylethanamine.
| Compound Name | 1-(3-chloro-4-iodophenyl)-2-(2,4-difluorophenyl)-N-methylethanamine |
|---|---|
| PubChem CID | 103214822 |
| Molecular Formula | C15H13ClF2IN |
| Molecular Weight | 407.63 g/mol |
| Exact Mass | 406.97 |
| IUPAC Name | 1-(3-chloro-4-iodophenyl)-2-(2,4-difluorophenyl)-N-methylethanamine |
| SMILES | CNC(Cc1ccc(F)cc1F)c1ccc(I)c(Cl)c1 |
| InChI | InChI=1S/C15H13ClF2IN/c1-20-15(10-3-5-14(19)12(16)6-10)7-9-2-4-11(17)8-13(9)18/h2-6,8,15,20H,7H2,1H3 |
| InChIKey | PKXCQIJEVFYROP-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.63 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|