C14H10ClF2IO — CID 103216689
1-(3-chloro-4-iodophenyl)-2-(2,4-difluorophenyl)ethanol (PubChem CID 103216689) has the molecular formula C14H10ClF2IO and a molecular weight of 394.59 g/mol. Its IUPAC name is 1-(3-chloro-4-iodophenyl)-2-(2,4-difluorophenyl)ethanol.
| Compound Name | 1-(3-chloro-4-iodophenyl)-2-(2,4-difluorophenyl)ethanol |
|---|---|
| PubChem CID | 103216689 |
| Molecular Formula | C14H10ClF2IO |
| Molecular Weight | 394.59 g/mol |
| Exact Mass | 393.94 |
| IUPAC Name | 1-(3-chloro-4-iodophenyl)-2-(2,4-difluorophenyl)ethanol |
| SMILES | OC(Cc1ccc(F)cc1F)c1ccc(I)c(Cl)c1 |
| InChI | InChI=1S/C14H10ClF2IO/c15-11-5-9(2-4-13(11)18)14(19)6-8-1-3-10(16)7-12(8)17/h1-5,7,14,19H,6H2 |
| InChIKey | LPULAERZNIDOOK-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.59 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|