C13H10Cl3IN2 — CID 103217225
[(3-chloro-4-iodophenyl)-(3,4-dichlorophenyl)methyl]hydrazine (PubChem CID 103217225) has the molecular formula C13H10Cl3IN2 and a molecular weight of 427.50 g/mol. Its IUPAC name is [(3-chloro-4-iodophenyl)-(3,4-dichlorophenyl)methyl]hydrazine.
| Compound Name | [(3-chloro-4-iodophenyl)-(3,4-dichlorophenyl)methyl]hydrazine |
|---|---|
| PubChem CID | 103217225 |
| Molecular Formula | C13H10Cl3IN2 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 425.90 |
| IUPAC Name | [(3-chloro-4-iodophenyl)-(3,4-dichlorophenyl)methyl]hydrazine |
| SMILES | NNC(c1ccc(Cl)c(Cl)c1)c1ccc(I)c(Cl)c1 |
| InChI | InChI=1S/C13H10Cl3IN2/c14-9-3-1-7(5-10(9)15)13(19-18)8-2-4-12(17)11(16)6-8/h1-6,13,19H,18H2 |
| InChIKey | NRIMIGQWRQAIQU-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|