C9H11Br2ClS — CID 102837073
3-bromo-5-(1-bromo-2,2-dimethylpropyl)-2-chlorothiophene (PubChem CID 102837073) has the molecular formula C9H11Br2ClS and a molecular weight of 346.52 g/mol. Its IUPAC name is 3-bromo-5-(1-bromo-2,2-dimethylpropyl)-2-chlorothiophene.
| Compound Name | 3-bromo-5-(1-bromo-2,2-dimethylpropyl)-2-chlorothiophene |
|---|---|
| PubChem CID | 102837073 |
| Molecular Formula | C9H11Br2ClS |
| Molecular Weight | 346.52 g/mol |
| Exact Mass | 343.86 |
| IUPAC Name | 3-bromo-5-(1-bromo-2,2-dimethylpropyl)-2-chlorothiophene |
| SMILES | CC(C)(C)C(Br)c1cc(Br)c(Cl)s1 |
| InChI | InChI=1S/C9H11Br2ClS/c1-9(2,3)7(11)6-4-5(10)8(12)13-6/h4,7H,1-3H3 |
| InChIKey | DKFQWDIYTMZJFT-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.52 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|