C9H11BrClNOS — CID 102844189
2-(4-bromo-5-methylthiophen-2-yl)-2-chloro-N,N-dimethylacetamide (PubChem CID 102844189) has the molecular formula C9H11BrClNOS and a molecular weight of 296.62 g/mol. Its IUPAC name is 2-(4-bromo-5-methylthiophen-2-yl)-2-chloro-N,N-dimethylacetamide.
| Compound Name | 2-(4-bromo-5-methylthiophen-2-yl)-2-chloro-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 102844189 |
| Molecular Formula | C9H11BrClNOS |
| Molecular Weight | 296.62 g/mol |
| Exact Mass | 294.94 |
| IUPAC Name | 2-(4-bromo-5-methylthiophen-2-yl)-2-chloro-N,N-dimethylacetamide |
| SMILES | Cc1sc(C(Cl)C(=O)N(C)C)cc1Br |
| InChI | InChI=1S/C9H11BrClNOS/c1-5-6(10)4-7(14-5)8(11)9(13)12(2)3/h4,8H,1-3H3 |
| InChIKey | FHRMCBSQMNUPEI-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.62 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|