C10H6Br3ClS2 — CID 107965047
2,5-dibromo-3-[(4-bromo-5-methylthiophen-2-yl)-chloromethyl]thiophene (PubChem CID 107965047) has the molecular formula C10H6Br3ClS2 and a molecular weight of 465.46 g/mol. Its IUPAC name is 2,5-dibromo-3-[(4-bromo-5-methylthiophen-2-yl)-chloromethyl]thiophene.
| Compound Name | 2,5-dibromo-3-[(4-bromo-5-methylthiophen-2-yl)-chloromethyl]thiophene |
|---|---|
| PubChem CID | 107965047 |
| Molecular Formula | C10H6Br3ClS2 |
| Molecular Weight | 465.46 g/mol |
| Exact Mass | 461.71 |
| IUPAC Name | 2,5-dibromo-3-[(4-bromo-5-methylthiophen-2-yl)-chloromethyl]thiophene |
| SMILES | Cc1sc(C(Cl)c2cc(Br)sc2Br)cc1Br |
| InChI | InChI=1S/C10H6Br3ClS2/c1-4-6(11)3-7(15-4)9(14)5-2-8(12)16-10(5)13/h2-3,9H,1H3 |
| InChIKey | BCZFWTCPPCUQEZ-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.46 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|