C13H11Br2ClS2 — CID 63436385
2-[chloro-(2,5-dibromothiophen-3-yl)methyl]-4,5,6,7-tetrahydro-1-benzothiophene (PubChem CID 63436385) has the molecular formula C13H11Br2ClS2 and a molecular weight of 426.63 g/mol. Its IUPAC name is 2-[chloro-(2,5-dibromothiophen-3-yl)methyl]-4,5,6,7-tetrahydro-1-benzothiophene.
| Compound Name | 2-[chloro-(2,5-dibromothiophen-3-yl)methyl]-4,5,6,7-tetrahydro-1-benzothiophene |
|---|---|
| PubChem CID | 63436385 |
| Molecular Formula | C13H11Br2ClS2 |
| Molecular Weight | 426.63 g/mol |
| Exact Mass | 423.84 |
| IUPAC Name | 2-[chloro-(2,5-dibromothiophen-3-yl)methyl]-4,5,6,7-tetrahydro-1-benzothiophene |
| SMILES | ClC(c1cc2c(s1)CCCC2)c1cc(Br)sc1Br |
| InChI | InChI=1S/C13H11Br2ClS2/c14-11-6-8(13(15)18-11)12(16)10-5-7-3-1-2-4-9(7)17-10/h5-6,12H,1-4H2 |
| InChIKey | YUWSTBPGOPHPCT-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.63 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|