C17H19ClS — CID 63430519
2-[chloro-(2,4-dimethylphenyl)methyl]-4,5,6,7-tetrahydro-1-benzothiophene (PubChem CID 63430519) has the molecular formula C17H19ClS and a molecular weight of 290.86 g/mol. Its IUPAC name is 2-[chloro-(2,4-dimethylphenyl)methyl]-4,5,6,7-tetrahydro-1-benzothiophene.
| Compound Name | 2-[chloro-(2,4-dimethylphenyl)methyl]-4,5,6,7-tetrahydro-1-benzothiophene |
|---|---|
| PubChem CID | 63430519 |
| Molecular Formula | C17H19ClS |
| Molecular Weight | 290.86 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | 2-[chloro-(2,4-dimethylphenyl)methyl]-4,5,6,7-tetrahydro-1-benzothiophene |
| SMILES | Cc1ccc(C(Cl)c2cc3c(s2)CCCC3)c(C)c1 |
| InChI | InChI=1S/C17H19ClS/c1-11-7-8-14(12(2)9-11)17(18)16-10-13-5-3-4-6-15(13)19-16/h7-10,17H,3-6H2,1-2H3 |
| InChIKey | BGDIVPVPAFDPLG-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.86 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|