C10H12Br2ClNOS — CID 102844190
2-chloro-2-(4,5-dibromothiophen-2-yl)-N,N-diethylacetamide (PubChem CID 102844190) has the molecular formula C10H12Br2ClNOS and a molecular weight of 389.54 g/mol. Its IUPAC name is 2-chloro-2-(4,5-dibromothiophen-2-yl)-N,N-diethylacetamide.
| Compound Name | 2-chloro-2-(4,5-dibromothiophen-2-yl)-N,N-diethylacetamide |
|---|---|
| PubChem CID | 102844190 |
| Molecular Formula | C10H12Br2ClNOS |
| Molecular Weight | 389.54 g/mol |
| Exact Mass | 386.87 |
| IUPAC Name | 2-chloro-2-(4,5-dibromothiophen-2-yl)-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)C(Cl)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C10H12Br2ClNOS/c1-3-14(4-2)10(15)8(13)7-5-6(11)9(12)16-7/h5,8H,3-4H2,1-2H3 |
| InChIKey | DFPPOZILDJOQRM-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.54 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|