C15H19BrClNO3 — CID 62224443
2-(6-bromo-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)-2-chloro-N,N-diethylacetamide (PubChem CID 62224443) has the molecular formula C15H19BrClNO3 and a molecular weight of 376.68 g/mol. Its IUPAC name is 2-(6-bromo-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)-2-chloro-N,N-diethylacetamide.
| Compound Name | 2-(6-bromo-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)-2-chloro-N,N-diethylacetamide |
|---|---|
| PubChem CID | 62224443 |
| Molecular Formula | C15H19BrClNO3 |
| Molecular Weight | 376.68 g/mol |
| Exact Mass | 375.02 |
| IUPAC Name | 2-(6-bromo-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)-2-chloro-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)C(Cl)c1cc(Br)c2c(c1)OCCCO2 |
| InChI | InChI=1S/C15H19BrClNO3/c1-3-18(4-2)15(19)13(17)10-8-11(16)14-12(9-10)20-6-5-7-21-14/h8-9,13H,3-7H2,1-2H3 |
| InChIKey | JRJXSPUVOODJSA-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.68 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|