C14H15BrClNO4 — CID 62224279
2-(5-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)-2-chloro-1-morpholin-4-ylethanone (PubChem CID 62224279) has the molecular formula C14H15BrClNO4 and a molecular weight of 376.63 g/mol. Its IUPAC name is 2-(5-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)-2-chloro-1-morpholin-4-ylethanone.
| Compound Name | 2-(5-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)-2-chloro-1-morpholin-4-ylethanone |
|---|---|
| PubChem CID | 62224279 |
| Molecular Formula | C14H15BrClNO4 |
| Molecular Weight | 376.63 g/mol |
| Exact Mass | 374.99 |
| IUPAC Name | 2-(5-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)-2-chloro-1-morpholin-4-ylethanone |
| SMILES | O=C(C(Cl)c1cc(Br)c2c(c1)OCCO2)N1CCOCC1 |
| InChI | InChI=1S/C14H15BrClNO4/c15-10-7-9(8-11-13(10)21-6-5-20-11)12(16)14(18)17-1-3-19-4-2-17/h7-8,12H,1-6H2 |
| InChIKey | JEFNGZSTIHLBOI-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.63 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|