C6H3Br2ClOS — CID 175222168
(2S)-2-chloro-2-(4,5-dibromothiophen-2-yl)acetaldehyde (PubChem CID 175222168) has the molecular formula C6H3Br2ClOS and a molecular weight of 318.42 g/mol. Its IUPAC name is (2S)-2-chloro-2-(4,5-dibromothiophen-2-yl)acetaldehyde.
| Compound Name | (2S)-2-chloro-2-(4,5-dibromothiophen-2-yl)acetaldehyde |
|---|---|
| PubChem CID | 175222168 |
| Molecular Formula | C6H3Br2ClOS |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 315.80 |
| IUPAC Name | (2S)-2-chloro-2-(4,5-dibromothiophen-2-yl)acetaldehyde |
| SMILES | O=C[C@H](Cl)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C6H3Br2ClOS/c7-3-1-5(4(9)2-10)11-6(3)8/h1-2,4H/t4-/m0/s1 |
| InChIKey | AEKFBUMHBZYUHR-BYPYZUCNSA-N |
| XLogP | 3.75 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|