C7H8Br2ClNS — CID 171235170
(1S)-1-(4,5-dibromothiophen-2-yl)prop-2-en-1-amine;hydrochloride (PubChem CID 171235170) has the molecular formula C7H8Br2ClNS and a molecular weight of 333.48 g/mol. Its IUPAC name is (1S)-1-(4,5-dibromothiophen-2-yl)prop-2-en-1-amine;hydrochloride.
| Compound Name | (1S)-1-(4,5-dibromothiophen-2-yl)prop-2-en-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171235170 |
| Molecular Formula | C7H8Br2ClNS |
| Molecular Weight | 333.48 g/mol |
| Exact Mass | 330.84 |
| IUPAC Name | (1S)-1-(4,5-dibromothiophen-2-yl)prop-2-en-1-amine;hydrochloride |
| SMILES | C=C[C@H](N)c1cc(Br)c(Br)s1.Cl |
| InChI | InChI=1S/C7H7Br2NS.ClH/c1-2-5(10)6-3-4(8)7(9)11-6;/h2-3,5H,1,10H2;1H/t5-;/m0./s1 |
| InChIKey | XXHFNJGSAZERAQ-JEDNCBNOSA-N |
| XLogP | 3.88 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.48 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|