C8H10BrNS — CID 131039487
(1S)-1-(5-bromo-4-methylthiophen-2-yl)prop-2-en-1-amine (PubChem CID 131039487) has the molecular formula C8H10BrNS and a molecular weight of 232.15 g/mol. Its IUPAC name is (1S)-1-(5-bromo-4-methylthiophen-2-yl)prop-2-en-1-amine.
| Compound Name | (1S)-1-(5-bromo-4-methylthiophen-2-yl)prop-2-en-1-amine |
|---|---|
| PubChem CID | 131039487 |
| Molecular Formula | C8H10BrNS |
| Molecular Weight | 232.15 g/mol |
| Exact Mass | 230.97 |
| IUPAC Name | (1S)-1-(5-bromo-4-methylthiophen-2-yl)prop-2-en-1-amine |
| SMILES | C=C[C@H](N)c1cc(C)c(Br)s1 |
| InChI | InChI=1S/C8H10BrNS/c1-3-6(10)7-4-5(2)8(9)11-7/h3-4,6H,1,10H2,2H3/t6-/m0/s1 |
| InChIKey | SDLUEIOUSSQFCL-LURJTMIESA-N |
| XLogP | 3.00 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.15 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|