C12H19BrCl2N2S — CID 171276296
1-[(1S)-1-(5-bromo-4-methylthiophen-2-yl)prop-2-enyl]piperazine;dihydrochloride (PubChem CID 171276296) has the molecular formula C12H19BrCl2N2S and a molecular weight of 374.18 g/mol. Its IUPAC name is 1-[(1S)-1-(5-bromo-4-methylthiophen-2-yl)prop-2-enyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1S)-1-(5-bromo-4-methylthiophen-2-yl)prop-2-enyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171276296 |
| Molecular Formula | C12H19BrCl2N2S |
| Molecular Weight | 374.18 g/mol |
| Exact Mass | 371.98 |
| IUPAC Name | 1-[(1S)-1-(5-bromo-4-methylthiophen-2-yl)prop-2-enyl]piperazine;dihydrochloride |
| SMILES | C=C[C@@H](c1cc(C)c(Br)s1)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C12H17BrN2S.2ClH/c1-3-10(15-6-4-14-5-7-15)11-8-9(2)12(13)16-11;;/h3,8,10,14H,1,4-7H2,2H3;2*1H/t10-;;/m0../s1 |
| InChIKey | DVFPUZWAPDOWNU-XRIOVQLTSA-N |
| XLogP | 3.79 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.18 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|