C15H25BrN2S — CID 171310839
1-[(1R)-1-(5-bromo-4-methylthiophen-2-yl)-4-methylpentyl]piperazine (PubChem CID 171310839) has the molecular formula C15H25BrN2S and a molecular weight of 345.35 g/mol. Its IUPAC name is 1-[(1R)-1-(5-bromo-4-methylthiophen-2-yl)-4-methylpentyl]piperazine.
| Compound Name | 1-[(1R)-1-(5-bromo-4-methylthiophen-2-yl)-4-methylpentyl]piperazine |
|---|---|
| PubChem CID | 171310839 |
| Molecular Formula | C15H25BrN2S |
| Molecular Weight | 345.35 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | 1-[(1R)-1-(5-bromo-4-methylthiophen-2-yl)-4-methylpentyl]piperazine |
| SMILES | Cc1cc([C@@H](CCC(C)C)N2CCNCC2)sc1Br |
| InChI | InChI=1S/C15H25BrN2S/c1-11(2)4-5-13(18-8-6-17-7-9-18)14-10-12(3)15(16)19-14/h10-11,13,17H,4-9H2,1-3H3/t13-/m1/s1 |
| InChIKey | JYNVXJGYGNVIPH-CYBMUJFWSA-N |
| XLogP | 4.20 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.35 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |