C12H16BrN3S — CID 171306721
(3R)-3-(5-bromo-4-methylthiophen-2-yl)-3-piperazin-1-ylpropanenitrile (PubChem CID 171306721) has the molecular formula C12H16BrN3S and a molecular weight of 314.25 g/mol. Its IUPAC name is (3R)-3-(5-bromo-4-methylthiophen-2-yl)-3-piperazin-1-ylpropanenitrile.
| Compound Name | (3R)-3-(5-bromo-4-methylthiophen-2-yl)-3-piperazin-1-ylpropanenitrile |
|---|---|
| PubChem CID | 171306721 |
| Molecular Formula | C12H16BrN3S |
| Molecular Weight | 314.25 g/mol |
| Exact Mass | 313.02 |
| IUPAC Name | (3R)-3-(5-bromo-4-methylthiophen-2-yl)-3-piperazin-1-ylpropanenitrile |
| SMILES | Cc1cc([C@@H](CC#N)N2CCNCC2)sc1Br |
| InChI | InChI=1S/C12H16BrN3S/c1-9-8-11(17-12(9)13)10(2-3-14)16-6-4-15-5-7-16/h8,10,15H,2,4-7H2,1H3/t10-/m1/s1 |
| InChIKey | BYSYIWITJAAMNX-SNVBAGLBSA-N |
| XLogP | 2.68 |
| TPSA | 39.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.25 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |