C10H14Br2N2OS — CID 102843442
2-(4,5-dibromothiophen-2-yl)-2-piperazin-1-ylethanol (PubChem CID 102843442) has the molecular formula C10H14Br2N2OS and a molecular weight of 370.11 g/mol. Its IUPAC name is 2-(4,5-dibromothiophen-2-yl)-2-piperazin-1-ylethanol.
| Compound Name | 2-(4,5-dibromothiophen-2-yl)-2-piperazin-1-ylethanol |
|---|---|
| PubChem CID | 102843442 |
| Molecular Formula | C10H14Br2N2OS |
| Molecular Weight | 370.11 g/mol |
| Exact Mass | 367.92 |
| IUPAC Name | 2-(4,5-dibromothiophen-2-yl)-2-piperazin-1-ylethanol |
| SMILES | OCC(c1cc(Br)c(Br)s1)N1CCNCC1 |
| InChI | InChI=1S/C10H14Br2N2OS/c11-7-5-9(16-10(7)12)8(6-15)14-3-1-13-2-4-14/h5,8,13,15H,1-4,6H2 |
| InChIKey | VVJPUBCSWUDXJG-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.11 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |