C10H14Br2N2S — CID 131430761
1-[(1S)-1-(4,5-dibromothiophen-2-yl)ethyl]piperazine (PubChem CID 131430761) has the molecular formula C10H14Br2N2S and a molecular weight of 354.11 g/mol. Its IUPAC name is 1-[(1S)-1-(4,5-dibromothiophen-2-yl)ethyl]piperazine.
| Compound Name | 1-[(1S)-1-(4,5-dibromothiophen-2-yl)ethyl]piperazine |
|---|---|
| PubChem CID | 131430761 |
| Molecular Formula | C10H14Br2N2S |
| Molecular Weight | 354.11 g/mol |
| Exact Mass | 351.92 |
| IUPAC Name | 1-[(1S)-1-(4,5-dibromothiophen-2-yl)ethyl]piperazine |
| SMILES | C[C@@H](c1cc(Br)c(Br)s1)N1CCNCC1 |
| InChI | InChI=1S/C10H14Br2N2S/c1-7(14-4-2-13-3-5-14)9-6-8(11)10(12)15-9/h6-7,13H,2-5H2,1H3/t7-/m0/s1 |
| InChIKey | JPBGKJSIZXIMFT-ZETCQYMHSA-N |
| XLogP | 3.24 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.11 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |