C13H20Br2N2S — CID 171305676
1-[(1S)-1-(4,5-dibromothiophen-2-yl)-2-methylbutyl]piperazine (PubChem CID 171305676) has the molecular formula C13H20Br2N2S and a molecular weight of 396.19 g/mol. Its IUPAC name is 1-[(1S)-1-(4,5-dibromothiophen-2-yl)-2-methylbutyl]piperazine.
| Compound Name | 1-[(1S)-1-(4,5-dibromothiophen-2-yl)-2-methylbutyl]piperazine |
|---|---|
| PubChem CID | 171305676 |
| Molecular Formula | C13H20Br2N2S |
| Molecular Weight | 396.19 g/mol |
| Exact Mass | 393.97 |
| IUPAC Name | 1-[(1S)-1-(4,5-dibromothiophen-2-yl)-2-methylbutyl]piperazine |
| SMILES | CCC(C)[C@@H](c1cc(Br)c(Br)s1)N1CCNCC1 |
| InChI | InChI=1S/C13H20Br2N2S/c1-3-9(2)12(17-6-4-16-5-7-17)11-8-10(14)13(15)18-11/h8-9,12,16H,3-7H2,1-2H3/t9?,12-/m0/s1 |
| InChIKey | WPSANQBBXJFBBH-ACGXKRRESA-N |
| XLogP | 4.27 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.19 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |