C14H26Cl2N2S — CID 171304419
1-[(1R)-2-methyl-1-(5-methylthiophen-2-yl)butyl]piperazine;dihydrochloride (PubChem CID 171304419) has the molecular formula C14H26Cl2N2S and a molecular weight of 325.35 g/mol. Its IUPAC name is 1-[(1R)-2-methyl-1-(5-methylthiophen-2-yl)butyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1R)-2-methyl-1-(5-methylthiophen-2-yl)butyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171304419 |
| Molecular Formula | C14H26Cl2N2S |
| Molecular Weight | 325.35 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | 1-[(1R)-2-methyl-1-(5-methylthiophen-2-yl)butyl]piperazine;dihydrochloride |
| SMILES | CCC(C)[C@H](c1ccc(C)s1)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C14H24N2S.2ClH/c1-4-11(2)14(13-6-5-12(3)17-13)16-9-7-15-8-10-16;;/h5-6,11,14-15H,4,7-10H2,1-3H3;2*1H/t11?,14-;;/m1../s1 |
| InChIKey | IHZXZNSRZIHAEQ-POEUQKCMSA-N |
| XLogP | 3.89 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.35 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |