C15H26Cl2N2S — CID 171288298
1-[(R)-cyclopentyl-(5-methylthiophen-2-yl)methyl]piperazine;dihydrochloride (PubChem CID 171288298) has the molecular formula C15H26Cl2N2S and a molecular weight of 337.36 g/mol. Its IUPAC name is 1-[(R)-cyclopentyl-(5-methylthiophen-2-yl)methyl]piperazine;dihydrochloride.
| Compound Name | 1-[(R)-cyclopentyl-(5-methylthiophen-2-yl)methyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171288298 |
| Molecular Formula | C15H26Cl2N2S |
| Molecular Weight | 337.36 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | 1-[(R)-cyclopentyl-(5-methylthiophen-2-yl)methyl]piperazine;dihydrochloride |
| SMILES | Cc1ccc([C@@H](C2CCCC2)N2CCNCC2)s1.Cl.Cl |
| InChI | InChI=1S/C15H24N2S.2ClH/c1-12-6-7-14(18-12)15(13-4-2-3-5-13)17-10-8-16-9-11-17;;/h6-7,13,15-16H,2-5,8-11H2,1H3;2*1H/t15-;;/m1../s1 |
| InChIKey | MJOWQDKREFZWDC-QCUBGVIVSA-N |
| XLogP | 4.04 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.36 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |