C17H28N2S — CID 171281355
1-[(S)-cyclohexyl-(5-ethylthiophen-2-yl)methyl]piperazine (PubChem CID 171281355) has the molecular formula C17H28N2S and a molecular weight of 292.49 g/mol. Its IUPAC name is 1-[(S)-cyclohexyl-(5-ethylthiophen-2-yl)methyl]piperazine.
| Compound Name | 1-[(S)-cyclohexyl-(5-ethylthiophen-2-yl)methyl]piperazine |
|---|---|
| PubChem CID | 171281355 |
| Molecular Formula | C17H28N2S |
| Molecular Weight | 292.49 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | 1-[(S)-cyclohexyl-(5-ethylthiophen-2-yl)methyl]piperazine |
| SMILES | CCc1ccc(C(C2CCCCC2)N2CCNCC2)s1 |
| InChI | InChI=1S/C17H28N2S/c1-2-15-8-9-16(20-15)17(14-6-4-3-5-7-14)19-12-10-18-11-13-19/h8-9,14,17-18H,2-7,10-13H2,1H3 |
| InChIKey | CACDKPKNJLVCDK-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.49 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |