C13H22Cl2N2S — CID 171275666
1-[(S)-cyclopropyl-(5-methylthiophen-2-yl)methyl]piperazine;dihydrochloride (PubChem CID 171275666) has the molecular formula C13H22Cl2N2S and a molecular weight of 309.31 g/mol. Its IUPAC name is 1-[(S)-cyclopropyl-(5-methylthiophen-2-yl)methyl]piperazine;dihydrochloride.
| Compound Name | 1-[(S)-cyclopropyl-(5-methylthiophen-2-yl)methyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171275666 |
| Molecular Formula | C13H22Cl2N2S |
| Molecular Weight | 309.31 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | 1-[(S)-cyclopropyl-(5-methylthiophen-2-yl)methyl]piperazine;dihydrochloride |
| SMILES | Cc1ccc([C@H](C2CC2)N2CCNCC2)s1.Cl.Cl |
| InChI | InChI=1S/C13H20N2S.2ClH/c1-10-2-5-12(16-10)13(11-3-4-11)15-8-6-14-7-9-15;;/h2,5,11,13-14H,3-4,6-9H2,1H3;2*1H/t13-;;/m0../s1 |
| InChIKey | WMKQIKVOIJIJAH-GXKRWWSZSA-N |
| XLogP | 3.26 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.31 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |