C11H19Cl2FN2S — CID 171275662
1-[(1S)-2-fluoro-1-(5-methylthiophen-2-yl)ethyl]piperazine;dihydrochloride (PubChem CID 171275662) has the molecular formula C11H19Cl2FN2S and a molecular weight of 301.26 g/mol. Its IUPAC name is 1-[(1S)-2-fluoro-1-(5-methylthiophen-2-yl)ethyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1S)-2-fluoro-1-(5-methylthiophen-2-yl)ethyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171275662 |
| Molecular Formula | C11H19Cl2FN2S |
| Molecular Weight | 301.26 g/mol |
| Exact Mass | 300.06 |
| IUPAC Name | 1-[(1S)-2-fluoro-1-(5-methylthiophen-2-yl)ethyl]piperazine;dihydrochloride |
| SMILES | Cc1ccc([C@H](CF)N2CCNCC2)s1.Cl.Cl |
| InChI | InChI=1S/C11H17FN2S.2ClH/c1-9-2-3-11(15-9)10(8-12)14-6-4-13-5-7-14;;/h2-3,10,13H,4-8H2,1H3;2*1H/t10-;;/m0../s1 |
| InChIKey | JWUUFZLENWLNIT-XRIOVQLTSA-N |
| XLogP | 2.82 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.26 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |