About 1-[(1S)-2-fluoro-1-(5-nitrothiophen-2-yl)ethyl]piperazine;dihydrochloride
1-[(1S)-2-fluoro-1-(5-nitrothiophen-2-yl)ethyl]piperazine;dihydrochloride (PubChem CID 171284440) has the molecular formula C10H16Cl2FN3O2S
and a molecular weight of 332.23 g/mol. Its IUPAC name is 1-[(1S)-2-fluoro-1-(5-nitrothiophen-2-yl)ethyl]piperazine;dihydrochloride.
Molecular Properties
| Compound Name | 1-[(1S)-2-fluoro-1-(5-nitrothiophen-2-yl)ethyl]piperazine;dihydrochloride |
| PubChem CID | 171284440 |
| Molecular Formula | C10H16Cl2FN3O2S |
| Molecular Weight | 332.23 g/mol |
| Exact Mass | 331.03 |
| IUPAC Name | 1-[(1S)-2-fluoro-1-(5-nitrothiophen-2-yl)ethyl]piperazine;dihydrochloride |
| SMILES | Cl.Cl.O=[N+]([O-])c1ccc([C@H](CF)N2CCNCC2)s1 |
| InChI | InChI=1S/C10H14FN3O2S.2ClH/c11-7-8(13-5-3-12-4-6-13)9-1-2-10(17-9)14(15)16;;/h1-2,8,12H,3-7H2;2*1H/t8-;;/m0../s1 |
| InChIKey | GRGPXBVXUOBREP-JZGIKJSDSA-N |
| XLogP | 2.42 |
| TPSA | 58.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.23 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[(1S)-2-fluoro-1-(5-nitrothiophen-2-yl)ethyl]piperazine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1S)-2-fluoro-1-(5-nitrothiophen-2-yl)ethyl]piperazine;dihydrochloride?
The IUPAC name of 1-[(1S)-2-fluoro-1-(5-nitrothiophen-2-yl)ethyl]piperazine;dihydrochloride (CID 171284440) is 1-[(1S)-2-fluoro-1-(5-nitrothiophen-2-yl)ethyl]piperazine;dihydrochloride.
What is the SMILES notation for 1-[(1S)-2-fluoro-1-(5-nitrothiophen-2-yl)ethyl]piperazine;dihydrochloride?
The canonical SMILES for 1-[(1S)-2-fluoro-1-(5-nitrothiophen-2-yl)ethyl]piperazine;dihydrochloride is Cl.Cl.O=[N+]([O-])c1ccc([C@H](CF)N2CCNCC2)s1.
What is the InChIKey of 1-[(1S)-2-fluoro-1-(5-nitrothiophen-2-yl)ethyl]piperazine;dihydrochloride?
The InChIKey is GRGPXBVXUOBREP-JZGIKJSDSA-N. The full InChI is InChI=1S/C10H14FN3O2S.2ClH/c11-7-8(13-5-3-12-4-6-13)9-1-2-10(17-9)14(15)16;;/h1-2,8,12H,3-7H2;2*1H/t8-;;/m0../s1.
What are the key properties of 1-[(1S)-2-fluoro-1-(5-nitrothiophen-2-yl)ethyl]piperazine;dihydrochloride?
1-[(1S)-2-fluoro-1-(5-nitrothiophen-2-yl)ethyl]piperazine;dihydrochloride has a molecular weight of 332.23 g/mol, XLogP of 2.42, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1S)-2-fluoro-1-(5-nitrothiophen-2-yl)ethyl]piperazine;dihydrochloride is sourced from PubChem (CID 171284440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).