C13H21Cl2N3O2S — CID 171284468
1-[(1S)-3-methyl-1-(5-nitrothiophen-2-yl)but-3-enyl]piperazine;dihydrochloride (PubChem CID 171284468) has the molecular formula C13H21Cl2N3O2S and a molecular weight of 354.30 g/mol. Its IUPAC name is 1-[(1S)-3-methyl-1-(5-nitrothiophen-2-yl)but-3-enyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1S)-3-methyl-1-(5-nitrothiophen-2-yl)but-3-enyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171284468 |
| Molecular Formula | C13H21Cl2N3O2S |
| Molecular Weight | 354.30 g/mol |
| Exact Mass | 353.07 |
| IUPAC Name | 1-[(1S)-3-methyl-1-(5-nitrothiophen-2-yl)but-3-enyl]piperazine;dihydrochloride |
| SMILES | C=C(C)C[C@@H](c1ccc([N+](=O)[O-])s1)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C13H19N3O2S.2ClH/c1-10(2)9-11(15-7-5-14-6-8-15)12-3-4-13(19-12)16(17)18;;/h3-4,11,14H,1,5-9H2,2H3;2*1H/t11-;;/m0../s1 |
| InChIKey | SOFWVSYYXBYWAJ-IDMXKUIJSA-N |
| XLogP | 3.41 |
| TPSA | 58.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.30 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|