C11H14N4O2S — CID 84757769
2-(1,4-diazepan-1-yl)-2-(5-nitrothiophen-2-yl)acetonitrile (PubChem CID 84757769) has the molecular formula C11H14N4O2S and a molecular weight of 266.33 g/mol. Its IUPAC name is 2-(1,4-diazepan-1-yl)-2-(5-nitrothiophen-2-yl)acetonitrile.
| Compound Name | 2-(1,4-diazepan-1-yl)-2-(5-nitrothiophen-2-yl)acetonitrile |
|---|---|
| PubChem CID | 84757769 |
| Molecular Formula | C11H14N4O2S |
| Molecular Weight | 266.33 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | 2-(1,4-diazepan-1-yl)-2-(5-nitrothiophen-2-yl)acetonitrile |
| SMILES | N#CC(c1ccc([N+](=O)[O-])s1)N1CCCNCC1 |
| InChI | InChI=1S/C11H14N4O2S/c12-8-9(14-6-1-4-13-5-7-14)10-2-3-11(18-10)15(16)17/h2-3,9,13H,1,4-7H2 |
| InChIKey | UJXVNIIAGCMCOK-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 82.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.33 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|