C10H13N3S — CID 8893243
(2S)-2-piperazin-1-yl-2-thiophen-2-ylacetonitrile (PubChem CID 8893243) has the molecular formula C10H13N3S and a molecular weight of 207.30 g/mol. Its IUPAC name is (2S)-2-piperazin-1-yl-2-thiophen-2-ylacetonitrile.
| Compound Name | (2S)-2-piperazin-1-yl-2-thiophen-2-ylacetonitrile |
|---|---|
| PubChem CID | 8893243 |
| Molecular Formula | C10H13N3S |
| Molecular Weight | 207.30 g/mol |
| Exact Mass | 207.08 |
| IUPAC Name | (2S)-2-piperazin-1-yl-2-thiophen-2-ylacetonitrile |
| SMILES | N#C[C@@H](c1cccs1)N1CCNCC1 |
| InChI | InChI=1S/C10H13N3S/c11-8-9(10-2-1-7-14-10)13-5-3-12-4-6-13/h1-2,7,9,12H,3-6H2/t9-/m0/s1 |
| InChIKey | FCDRHDKGKBAGPP-VIFPVBQESA-N |
| XLogP | 1.22 |
| TPSA | 39.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.30 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |