C11H16ClN3S — CID 45261293
2-(4-methylpiperazin-1-yl)-2-thiophen-2-ylacetonitrile;hydrochloride (PubChem CID 45261293) has the molecular formula C11H16ClN3S and a molecular weight of 257.79 g/mol. Its IUPAC name is 2-(4-methylpiperazin-1-yl)-2-thiophen-2-ylacetonitrile;hydrochloride.
| Compound Name | 2-(4-methylpiperazin-1-yl)-2-thiophen-2-ylacetonitrile;hydrochloride |
|---|---|
| PubChem CID | 45261293 |
| Molecular Formula | C11H16ClN3S |
| Molecular Weight | 257.79 g/mol |
| Exact Mass | 257.08 |
| IUPAC Name | 2-(4-methylpiperazin-1-yl)-2-thiophen-2-ylacetonitrile;hydrochloride |
| SMILES | CN1CCN(C(C#N)c2cccs2)CC1.Cl |
| InChI | InChI=1S/C11H15N3S.ClH/c1-13-4-6-14(7-5-13)10(9-12)11-3-2-8-15-11;/h2-3,8,10H,4-7H2,1H3;1H |
| InChIKey | NGTWVRHKEZOPOO-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 30.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.79 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |