C17H18FN3O2S2 — CID 110349488
2-[4-[(4-fluorophenyl)methylsulfonyl]piperazin-1-yl]-2-thiophen-2-ylacetonitrile (PubChem CID 110349488) has the molecular formula C17H18FN3O2S2 and a molecular weight of 379.48 g/mol. Its IUPAC name is 2-[4-[(4-fluorophenyl)methylsulfonyl]piperazin-1-yl]-2-thiophen-2-ylacetonitrile.
| Compound Name | 2-[4-[(4-fluorophenyl)methylsulfonyl]piperazin-1-yl]-2-thiophen-2-ylacetonitrile |
|---|---|
| PubChem CID | 110349488 |
| Molecular Formula | C17H18FN3O2S2 |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.08 |
| IUPAC Name | 2-[4-[(4-fluorophenyl)methylsulfonyl]piperazin-1-yl]-2-thiophen-2-ylacetonitrile |
| SMILES | N#CC(c1cccs1)N1CCN(S(=O)(=O)Cc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C17H18FN3O2S2/c18-15-5-3-14(4-6-15)13-25(22,23)21-9-7-20(8-10-21)16(12-19)17-2-1-11-24-17/h1-6,11,16H,7-10,13H2 |
| InChIKey | LFWUOWBHLPMALL-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 64.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |