C20H22FN3O2S — CID 110349647
2-[4-(4-ethylphenyl)sulfonylpiperazin-1-yl]-2-(4-fluorophenyl)acetonitrile (PubChem CID 110349647) has the molecular formula C20H22FN3O2S and a molecular weight of 387.48 g/mol. Its IUPAC name is 2-[4-(4-ethylphenyl)sulfonylpiperazin-1-yl]-2-(4-fluorophenyl)acetonitrile.
| Compound Name | 2-[4-(4-ethylphenyl)sulfonylpiperazin-1-yl]-2-(4-fluorophenyl)acetonitrile |
|---|---|
| PubChem CID | 110349647 |
| Molecular Formula | C20H22FN3O2S |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | 2-[4-(4-ethylphenyl)sulfonylpiperazin-1-yl]-2-(4-fluorophenyl)acetonitrile |
| SMILES | CCc1ccc(S(=O)(=O)N2CCN(C(C#N)c3ccc(F)cc3)CC2)cc1 |
| InChI | InChI=1S/C20H22FN3O2S/c1-2-16-3-9-19(10-4-16)27(25,26)24-13-11-23(12-14-24)20(15-22)17-5-7-18(21)8-6-17/h3-10,20H,2,11-14H2,1H3 |
| InChIKey | CAGNPWOUAWHMPX-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 64.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |